C22H15N3O3S — CID 9309854
[(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate (PubChem CID 9309854) has the molecular formula C22H15N3O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 9309854 |
| Molecular Formula | C22H15N3O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [(2R)-1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1-c1ccccc1C#N)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C22H15N3O3S/c1-14(20(26)25-21-16(13-24)10-11-29-21)28-22(27)19-9-5-4-8-18(19)17-7-3-2-6-15(17)12-23/h2-11,14H,1H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | HWVBDRBROAVPJU-CQSZACIVSA-N |
| XLogP | 4.34 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |