C23H17FN2O3 — CID 8701979
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate (PubChem CID 8701979) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 8701979 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1-c1ccccc1C#N)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H17FN2O3/c1-15(22(27)26-21-13-7-6-12-20(21)24)29-23(28)19-11-5-4-10-18(19)17-9-3-2-8-16(17)14-25/h2-13,15H,1H3,(H,26,27)/t15-/m0/s1 |
| InChIKey | JBTADMSHFXVRHU-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |