C17H11ClF2N2O3 — CID 8753085
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 8753085) has the molecular formula C17H11ClF2N2O3 and a molecular weight of 364.74 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 8753085 |
| Molecular Formula | C17H11ClF2N2O3 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)c(F)cc1Cl)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C17H11ClF2N2O3/c1-9(16(23)22-15-5-3-2-4-10(15)8-21)25-17(24)11-6-13(19)14(20)7-12(11)18/h2-7,9H,1H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | XHHPAIXARGGRHQ-SECBINFHSA-N |
| XLogP | 3.67 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|