C17H12ClFN2O3 — CID 8764233
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate (PubChem CID 8764233) has the molecular formula C17H12ClFN2O3 and a molecular weight of 346.75 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 8764233 |
| Molecular Formula | C17H12ClFN2O3 |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(F)cc1Cl)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C17H12ClFN2O3/c1-10(16(22)21-15-5-3-2-4-11(15)9-20)24-17(23)13-7-6-12(19)8-14(13)18/h2-8,10H,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | CQHOYYAKXFVUQE-SNVBAGLBSA-N |
| XLogP | 3.53 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |