C18H16ClN3O4 — CID 8764580
[(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 8764580) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 8764580 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [(2R)-1-(2-cyanoanilino)-1-oxopropan-2-yl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)O[C@H](C)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C18H16ClN3O4/c1-10(17(23)22-15-6-4-3-5-11(15)9-20)26-18(24)12-7-13(19)14(21)8-16(12)25-2/h3-8,10H,21H2,1-2H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | MCKJVZXIFHIJGP-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|