C16H11Cl3FNO3 — CID 16529440
[1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate (PubChem CID 16529440) has the molecular formula C16H11Cl3FNO3 and a molecular weight of 390.63 g/mol. Its IUPAC name is [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate.
| Compound Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 16529440 |
| Molecular Formula | C16H11Cl3FNO3 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | [1-(2,5-dichloroanilino)-1-oxopropan-2-yl] 2-chloro-4-fluorobenzoate |
| SMILES | CC(OC(=O)c1ccc(F)cc1Cl)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H11Cl3FNO3/c1-8(15(22)21-14-6-9(17)2-5-12(14)18)24-16(23)11-4-3-10(20)7-13(11)19/h2-8H,1H3,(H,21,22) |
| InChIKey | XOOGYTKBEXPNLV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |