C23H16F2N2O3 — CID 9309839
[(2R)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate (PubChem CID 9309839) has the molecular formula C23H16F2N2O3 and a molecular weight of 406.39 g/mol. Its IUPAC name is [(2R)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [(2R)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 9309839 |
| Molecular Formula | C23H16F2N2O3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [(2R)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 2-(2-cyanophenyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1-c1ccccc1C#N)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C23H16F2N2O3/c1-14(22(28)27-21-19(24)11-6-12-20(21)25)30-23(29)18-10-5-4-9-17(18)16-8-3-2-7-15(16)13-26/h2-12,14H,1H3,(H,27,28)/t14-/m1/s1 |
| InChIKey | IJGZHGWXVRBMGG-CQSZACIVSA-N |
| XLogP | 4.69 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |