C23H13N3O7S — CID 43056303
[1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 43056303) has the molecular formula C23H13N3O7S and a molecular weight of 475.44 g/mol. Its IUPAC name is [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 43056303 |
| Molecular Formula | C23H13N3O7S |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | [1-[(3-cyanothiophen-2-yl)amino]-1-oxopropan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C23H13N3O7S/c1-11(21(29)25-22-12(10-24)8-9-34-22)33-23(30)16-7-6-15-17(18(16)26(31)32)20(28)14-5-3-2-4-13(14)19(15)27/h2-9,11H,1H3,(H,25,29) |
| InChIKey | NIESSUQVOFCVGW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|