C25H18N2O7 — CID 46814038
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate (PubChem CID 46814038) has the molecular formula C25H18N2O7 and a molecular weight of 458.43 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 46814038 |
| Molecular Formula | C25H18N2O7 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18N2O7/c1-13-15(9-6-12-20(13)27(32)33)25(31)34-14(2)24(30)26-19-11-5-10-18-21(19)23(29)17-8-4-3-7-16(17)22(18)28/h3-12,14H,1-2H3,(H,26,30) |
| InChIKey | HPPLFXHQXTTYNN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|