C22H14N4O7 — CID 55567783
[1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55567783) has the molecular formula C22H14N4O7 and a molecular weight of 446.38 g/mol. Its IUPAC name is [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55567783 |
| Molecular Formula | C22H14N4O7 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O)C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C22H14N4O7/c1-11(20(29)25-22-23-9-4-10-24-22)33-21(30)15-8-7-14-16(17(15)26(31)32)19(28)13-6-3-2-5-12(13)18(14)27/h2-11H,1H3,(H,23,24,25,29) |
| InChIKey | DYOCWBZWDHGYQA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|