C22H14N2O6 — CID 4917485
N-(4-methoxyphenyl)-1-nitro-9,10-dioxoanthracene-2-carboxamide (PubChem CID 4917485) has the molecular formula C22H14N2O6 and a molecular weight of 402.36 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-nitro-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-nitro-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 4917485 |
| Molecular Formula | C22H14N2O6 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(4-methoxyphenyl)-1-nitro-9,10-dioxoanthracene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(c2[N+](=O)[O-])C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H14N2O6/c1-30-13-8-6-12(7-9-13)23-22(27)17-11-10-16-18(19(17)24(28)29)21(26)15-5-3-2-4-14(15)20(16)25/h2-11H,1H3,(H,23,27) |
| InChIKey | OWXGOKPYAVKZEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|