C20H16N2O8 — CID 7694426
[2-(2-methoxyethylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 7694426) has the molecular formula C20H16N2O8 and a molecular weight of 412.35 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 7694426 |
| Molecular Formula | C20H16N2O8 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | COCCNC(=O)COC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H16N2O8/c1-29-9-8-21-15(23)10-30-20(26)14-7-6-13-16(17(14)22(27)28)19(25)12-5-3-2-4-11(12)18(13)24/h2-7H,8-10H2,1H3,(H,21,23) |
| InChIKey | UXCSDCRDEWRYDR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|