C22H12BrNO6 — CID 3468193
(4-bromophenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 3468193) has the molecular formula C22H12BrNO6 and a molecular weight of 466.24 g/mol. Its IUPAC name is (4-bromophenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-bromophenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 3468193 |
| Molecular Formula | C22H12BrNO6 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | (4-bromophenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)OCc1ccc(Br)cc1)c2[N+](=O)[O-] |
| InChI | InChI=1S/C22H12BrNO6/c23-13-7-5-12(6-8-13)11-30-22(27)17-10-9-16-18(19(17)24(28)29)21(26)15-4-2-1-3-14(15)20(16)25/h1-10H,11H2 |
| InChIKey | QLNYQSFCVPUEMS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|