C25H19NO7 — CID 46805477
2-(3,5-dimethylphenoxy)ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 46805477) has the molecular formula C25H19NO7 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | 2-(3,5-dimethylphenoxy)ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 46805477 |
| Molecular Formula | C25H19NO7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1cc(C)cc(OCCOC(=O)c2ccc3c(c2[N+](=O)[O-])C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C25H19NO7/c1-14-11-15(2)13-16(12-14)32-9-10-33-25(29)20-8-7-19-21(22(20)26(30)31)24(28)18-6-4-3-5-17(18)23(19)27/h3-8,11-13H,9-10H2,1-2H3 |
| InChIKey | CAPSOMNTDUEAMW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|