C19H12N6O6 — CID 55390026
(4,6-diamino-1,3,5-triazin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55390026) has the molecular formula C19H12N6O6 and a molecular weight of 420.34 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55390026 |
| Molecular Formula | C19H12N6O6 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Nc1nc(N)nc(COC(=O)c2ccc3c(c2[N+](=O)[O-])C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C19H12N6O6/c20-18-22-12(23-19(21)24-18)7-31-17(28)11-6-5-10-13(14(11)25(29)30)16(27)9-4-2-1-3-8(9)15(10)26/h1-6H,7H2,(H4,20,21,22,23,24) |
| InChIKey | KDZRTBGPXWZQEI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 194.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|