C21H10ClNO7S — CID 4192753
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 4192753) has the molecular formula C21H10ClNO7S and a molecular weight of 455.83 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 4192753 |
| Molecular Formula | C21H10ClNO7S |
| Molecular Weight | 455.83 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H10ClNO7S/c22-16-8-7-15(31-16)14(24)9-30-21(27)13-6-5-12-17(18(13)23(28)29)20(26)11-4-2-1-3-10(11)19(12)25/h1-8H,9H2 |
| InChIKey | WSPHVCZDCUPYIL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|