C23H15NO6 — CID 7694425
(4-methylphenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 7694425) has the molecular formula C23H15NO6 and a molecular weight of 401.37 g/mol. Its IUPAC name is (4-methylphenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-methylphenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 7694425 |
| Molecular Formula | C23H15NO6 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (4-methylphenyl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1ccc(COC(=O)c2ccc3c(c2[N+](=O)[O-])C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H15NO6/c1-13-6-8-14(9-7-13)12-30-23(27)18-11-10-17-19(20(18)24(28)29)22(26)16-5-3-2-4-15(16)21(17)25/h2-11H,12H2,1H3 |
| InChIKey | NOPSMMKHGCJGSV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|