C27H22N2O7 — CID 42583993
ethyl (3S)-3-(4-methylphenyl)-3-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]propanoate (PubChem CID 42583993) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is ethyl (3S)-3-(4-methylphenyl)-3-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]propanoate.
| Compound Name | ethyl (3S)-3-(4-methylphenyl)-3-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 42583993 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | ethyl (3S)-3-(4-methylphenyl)-3-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H22N2O7/c1-3-36-22(30)14-21(16-10-8-15(2)9-11-16)28-27(33)20-13-12-19-23(24(20)29(34)35)26(32)18-7-5-4-6-17(18)25(19)31/h4-13,21H,3,14H2,1-2H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | GZXIWFWZAGBXET-NRFANRHFSA-N |
| XLogP | 4.10 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|