C20H23NO4 — CID 4042935
ethyl 3-(4-methoxyphenyl)-3-[(2-methylbenzoyl)amino]propanoate (PubChem CID 4042935) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 3-(4-methoxyphenyl)-3-[(2-methylbenzoyl)amino]propanoate.
| Compound Name | ethyl 3-(4-methoxyphenyl)-3-[(2-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 4042935 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 3-(4-methoxyphenyl)-3-[(2-methylbenzoyl)amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1ccccc1C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-4-25-19(22)13-18(15-9-11-16(24-3)12-10-15)21-20(23)17-8-6-5-7-14(17)2/h5-12,18H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | GMRCQRLVBPLOCH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |