C22H21NO6 — CID 7044549
ethyl (3S)-3-(4-methoxyphenyl)-3-[(2-oxochromene-3-carbonyl)amino]propanoate (PubChem CID 7044549) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is ethyl (3S)-3-(4-methoxyphenyl)-3-[(2-oxochromene-3-carbonyl)amino]propanoate.
| Compound Name | ethyl (3S)-3-(4-methoxyphenyl)-3-[(2-oxochromene-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 7044549 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl (3S)-3-(4-methoxyphenyl)-3-[(2-oxochromene-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)c1cc2ccccc2oc1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-3-28-20(24)13-18(14-8-10-16(27-2)11-9-14)23-21(25)17-12-15-6-4-5-7-19(15)29-22(17)26/h4-12,18H,3,13H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | ULZNSJWUIBSMNE-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|