C23H22BrNO7 — CID 3952088
ethyl 3-[(6-bromo-8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 3952088) has the molecular formula C23H22BrNO7 and a molecular weight of 504.33 g/mol. Its IUPAC name is ethyl 3-[(6-bromo-8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[(6-bromo-8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 3952088 |
| Molecular Formula | C23H22BrNO7 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | ethyl 3-[(6-bromo-8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1cc2cc(Br)cc(OC)c2oc1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H22BrNO7/c1-4-31-20(26)12-18(13-5-7-16(29-2)8-6-13)25-22(27)17-10-14-9-15(24)11-19(30-3)21(14)32-23(17)28/h5-11,18H,4,12H2,1-3H3,(H,25,27) |
| InChIKey | NWHAVCGGVLBUNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|