C23H23NO7 — CID 4010432
ethyl 3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 4010432) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is ethyl 3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 4010432 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | ethyl 3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1cc2cccc(OC)c2oc1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23NO7/c1-4-30-20(25)13-18(14-8-10-16(28-2)11-9-14)24-22(26)17-12-15-6-5-7-19(29-3)21(15)31-23(17)27/h5-12,18H,4,13H2,1-3H3,(H,24,26) |
| InChIKey | SANWKUSGTHDNMQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|