C20H18N2O7 — CID 146000873
8-ethoxy-N'-(2-hydroxy-5-methoxybenzoyl)-2-oxochromene-3-carbohydrazide (PubChem CID 146000873) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is 8-ethoxy-N'-(2-hydroxy-5-methoxybenzoyl)-2-oxochromene-3-carbohydrazide.
| Compound Name | 8-ethoxy-N'-(2-hydroxy-5-methoxybenzoyl)-2-oxochromene-3-carbohydrazide |
|---|---|
| PubChem CID | 146000873 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 8-ethoxy-N'-(2-hydroxy-5-methoxybenzoyl)-2-oxochromene-3-carbohydrazide |
| SMILES | CCOc1cccc2cc(C(=O)NNC(=O)c3cc(OC)ccc3O)c(=O)oc12 |
| InChI | InChI=1S/C20H18N2O7/c1-3-28-16-6-4-5-11-9-14(20(26)29-17(11)16)19(25)22-21-18(24)13-10-12(27-2)7-8-15(13)23/h4-10,23H,3H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | PEVWEVFFFWIMNW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|