C20H27NO4 — CID 25252554
8-ethoxy-2-oxo-N-(2,4,4-trimethylpentan-2-yl)chromene-3-carboxamide (PubChem CID 25252554) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 8-ethoxy-2-oxo-N-(2,4,4-trimethylpentan-2-yl)chromene-3-carboxamide.
| Compound Name | 8-ethoxy-2-oxo-N-(2,4,4-trimethylpentan-2-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 25252554 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 8-ethoxy-2-oxo-N-(2,4,4-trimethylpentan-2-yl)chromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)NC(C)(C)CC(C)(C)C)c(=O)oc12 |
| InChI | InChI=1S/C20H27NO4/c1-7-24-15-10-8-9-13-11-14(18(23)25-16(13)15)17(22)21-20(5,6)12-19(2,3)4/h8-11H,7,12H2,1-6H3,(H,21,22) |
| InChIKey | IXEGFDNUBJFADZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|