C20H21N3O5 — CID 121119543
8-ethoxy-N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 121119543) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 8-ethoxy-N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-ethoxy-N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121119543 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 8-ethoxy-N-[2-(4-ethyl-6-oxopyrimidin-1-yl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CCOc1cccc2cc(C(=O)NCCn3cnc(CC)cc3=O)c(=O)oc12 |
| InChI | InChI=1S/C20H21N3O5/c1-3-14-11-17(24)23(12-22-14)9-8-21-19(25)15-10-13-6-5-7-16(27-4-2)18(13)28-20(15)26/h5-7,10-12H,3-4,8-9H2,1-2H3,(H,21,25) |
| InChIKey | VXJVRUZXPPMPER-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|