C24H16N2O7 — CID 3908606
ethyl 4-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]benzoate (PubChem CID 3908606) has the molecular formula C24H16N2O7 and a molecular weight of 444.40 g/mol. Its IUPAC name is ethyl 4-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 3908606 |
| Molecular Formula | C24H16N2O7 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | ethyl 4-[(1-nitro-9,10-dioxoanthracene-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc3c(c2[N+](=O)[O-])C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H16N2O7/c1-2-33-24(30)13-7-9-14(10-8-13)25-23(29)18-12-11-17-19(20(18)26(31)32)22(28)16-6-4-3-5-15(16)21(17)27/h3-12H,2H2,1H3,(H,25,29) |
| InChIKey | NQLLXCCAQJJDDV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|