C26H19NO7 — CID 42967790
[2-(4-ethoxycarbonylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 42967790) has the molecular formula C26H19NO7 and a molecular weight of 457.44 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 42967790 |
| Molecular Formula | C26H19NO7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H19NO7/c1-2-33-25(31)15-10-12-16(13-11-15)27-21(28)14-34-26(32)20-9-5-8-19-22(20)24(30)18-7-4-3-6-17(18)23(19)29/h3-13H,2,14H2,1H3,(H,27,28) |
| InChIKey | VWYIDEOGTLICBT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|