C23H14FNO5 — CID 5069539
[2-(4-fluoroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 5069539) has the molecular formula C23H14FNO5 and a molecular weight of 403.37 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 5069539 |
| Molecular Formula | C23H14FNO5 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H14FNO5/c24-13-8-10-14(11-9-13)25-19(26)12-30-23(29)18-7-3-6-17-20(18)22(28)16-5-2-1-4-15(16)21(17)27/h1-11H,12H2,(H,25,26) |
| InChIKey | LXISBKNUROBYAX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|