C24H17NO5 — CID 4622092
[2-(benzylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 4622092) has the molecular formula C24H17NO5 and a molecular weight of 399.40 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 4622092 |
| Molecular Formula | C24H17NO5 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H17NO5/c26-20(25-13-15-7-2-1-3-8-15)14-30-24(29)19-12-6-11-18-21(19)23(28)17-10-5-4-9-16(17)22(18)27/h1-12H,13-14H2,(H,25,26) |
| InChIKey | MPMKAKZOCYQQGQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|