C25H27NO5 — CID 9019978
[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 9019978) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 9019978 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H27NO5/c1-24(2,3)14-25(4,5)26-19(27)13-31-23(30)18-12-8-11-17-20(18)22(29)16-10-7-6-9-15(16)21(17)28/h6-12H,13-14H2,1-5H3,(H,26,27) |
| InChIKey | MLEGVRSMRDMEBC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|