C24H23NO5 — CID 7969722
[2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 7969722) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 7969722 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H23NO5/c1-14-7-2-5-12-19(14)25-20(26)13-30-24(29)18-11-6-10-17-21(18)23(28)16-9-4-3-8-15(16)22(17)27/h3-4,6,8-11,14,19H,2,5,7,12-13H2,1H3,(H,25,26)/t14-,19+/m0/s1 |
| InChIKey | KLWCMMNIZMLSMK-IFXJQAMLSA-N |
| XLogP | 3.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|