C17H24N2O3 — CID 46815202
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-amino-3-methylbenzoate (PubChem CID 46815202) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-amino-3-methylbenzoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 46815202 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NC2CCCCC2C)c1N |
| InChI | InChI=1S/C17H24N2O3/c1-11-6-3-4-9-14(11)19-15(20)10-22-17(21)13-8-5-7-12(2)16(13)18/h5,7-8,11,14H,3-4,6,9-10,18H2,1-2H3,(H,19,20) |
| InChIKey | AEONCKUEFUQDBY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|