C23H25NO4 — CID 7470473
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 7470473) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7470473 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)COC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25NO4/c1-16-9-5-8-14-20(16)24-21(25)15-28-23(27)19-13-7-6-12-18(19)22(26)17-10-3-2-4-11-17/h2-4,6-7,10-13,16,20H,5,8-9,14-15H2,1H3,(H,24,25)/t16-,20+/m1/s1 |
| InChIKey | AHDLEHNSDIJWDR-UZLBHIALSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |