C25H29NO4 — CID 23988447
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 23988447) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 23988447 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC2CCCC(C)C2C)cc1 |
| InChI | InChI=1S/C25H29NO4/c1-16-11-13-19(14-12-16)24(28)20-8-4-5-9-21(20)25(29)30-15-23(27)26-22-10-6-7-17(2)18(22)3/h4-5,8-9,11-14,17-18,22H,6-7,10,15H2,1-3H3,(H,26,27) |
| InChIKey | URDLHXYWRBUZJG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |