C25H27NO5 — CID 9019974
[2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 9019974) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 9019974 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CC(C)CCC[C@@H](C)NC(=O)COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H27NO5/c1-15(2)8-6-9-16(3)26-21(27)14-31-25(30)20-13-7-12-19-22(20)24(29)18-11-5-4-10-17(18)23(19)28/h4-5,7,10-13,15-16H,6,8-9,14H2,1-3H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | ROAWJHYEXSSMHH-MRXNPFEDSA-N |
| XLogP | 3.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|