C17H24N4O3 — CID 99794821
[2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 2H-benzotriazole-4-carboxylate (PubChem CID 99794821) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 2H-benzotriazole-4-carboxylate.
| Compound Name | [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 2H-benzotriazole-4-carboxylate |
|---|---|
| PubChem CID | 99794821 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [2-[[(2R)-6-methylheptan-2-yl]amino]-2-oxoethyl] 2H-benzotriazole-4-carboxylate |
| SMILES | CC(C)CCC[C@@H](C)NC(=O)COC(=O)c1cccc2n[nH]nc12 |
| InChI | InChI=1S/C17H24N4O3/c1-11(2)6-4-7-12(3)18-15(22)10-24-17(23)13-8-5-9-14-16(13)20-21-19-14/h5,8-9,11-12H,4,6-7,10H2,1-3H3,(H,18,22)(H,19,20,21)/t12-/m1/s1 |
| InChIKey | ZZQLZZDKYBTEQM-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |