C25H26N2O7 — CID 46828623
[2-(6-methylheptan-2-ylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 46828623) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 46828623 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [2-(6-methylheptan-2-ylamino)-2-oxoethyl] 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(C)CCCC(C)NC(=O)COC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H26N2O7/c1-14(2)7-6-8-15(3)26-20(28)13-34-25(31)19-12-11-18-21(22(19)27(32)33)24(30)17-10-5-4-9-16(17)23(18)29/h4-5,9-12,14-15H,6-8,13H2,1-3H3,(H,26,28) |
| InChIKey | BKPJKPOSWRYEKB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|