C30H14N4O10 — CID 6115087
1-nitro-N'-(1-nitro-9,10-dioxoanthracene-2-carbonyl)-9,10-dioxoanthracene-2-carbohydrazide (PubChem CID 6115087) has the molecular formula C30H14N4O10 and a molecular weight of 590.46 g/mol. Its IUPAC name is 1-nitro-N'-(1-nitro-9,10-dioxoanthracene-2-carbonyl)-9,10-dioxoanthracene-2-carbohydrazide.
| Compound Name | 1-nitro-N'-(1-nitro-9,10-dioxoanthracene-2-carbonyl)-9,10-dioxoanthracene-2-carbohydrazide |
|---|---|
| PubChem CID | 6115087 |
| Molecular Formula | C30H14N4O10 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 1-nitro-N'-(1-nitro-9,10-dioxoanthracene-2-carbonyl)-9,10-dioxoanthracene-2-carbohydrazide |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)NNC(=O)c1ccc3c(c1[N+](=O)[O-])C(=O)c1ccccc1C3=O)c2[N+](=O)[O-] |
| InChI | InChI=1S/C30H14N4O10/c35-25-13-5-1-3-7-15(13)27(37)21-17(25)9-11-19(23(21)33(41)42)29(39)31-32-30(40)20-12-10-18-22(24(20)34(43)44)28(38)16-8-4-2-6-14(16)26(18)36/h1-12H,(H,31,39)(H,32,40) |
| InChIKey | HRKJWVBTIZPZJV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 212.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|