C17H11NO6 — CID 12756415
ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 12756415) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 12756415 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | ethyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11NO6/c1-2-24-17(21)12-8-7-11-13(14(12)18(22)23)16(20)10-6-4-3-5-9(10)15(11)19/h3-8H,2H2,1H3 |
| InChIKey | YFFNXJUPKJZNHC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|