C9H9N3O2 — CID 14534407
ethyl 2H-benzotriazole-4-carboxylate (PubChem CID 14534407) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is ethyl 2H-benzotriazole-4-carboxylate.
| Compound Name | ethyl 2H-benzotriazole-4-carboxylate |
|---|---|
| PubChem CID | 14534407 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | ethyl 2H-benzotriazole-4-carboxylate |
| SMILES | CCOC(=O)c1cccc2n[nH]nc12 |
| InChI | InChI=1S/C9H9N3O2/c1-2-14-9(13)6-4-3-5-7-8(6)11-12-10-7/h3-5H,2H2,1H3,(H,10,11,12) |
| InChIKey | ZORKMHGGKJGYQT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |