C22H15NO6 — CID 7969840
[2-(furan-2-ylmethylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 7969840) has the molecular formula C22H15NO6 and a molecular weight of 389.36 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 7969840 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O)NCc1ccco1 |
| InChI | InChI=1S/C22H15NO6/c24-18(23-11-13-5-4-10-28-13)12-29-22(27)17-9-3-8-16-19(17)21(26)15-7-2-1-6-14(15)20(16)25/h1-10H,11-12H2,(H,23,24) |
| InChIKey | SDPZERIJUKGJGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|