C16H13N3O4 — CID 23971743
[2-(furan-2-ylmethylamino)-2-oxoethyl] quinoxaline-5-carboxylate (PubChem CID 23971743) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] quinoxaline-5-carboxylate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] quinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 23971743 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] quinoxaline-5-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2nccnc12)NCc1ccco1 |
| InChI | InChI=1S/C16H13N3O4/c20-14(19-9-11-3-2-8-22-11)10-23-16(21)12-4-1-5-13-15(12)18-7-6-17-13/h1-8H,9-10H2,(H,19,20) |
| InChIKey | ULPRWYVINCJISF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |