C15H13N3O3 — CID 51362583
N-(furan-2-ylmethyl)-2-quinoxalin-6-yloxyacetamide (PubChem CID 51362583) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-quinoxalin-6-yloxyacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-quinoxalin-6-yloxyacetamide |
|---|---|
| PubChem CID | 51362583 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-quinoxalin-6-yloxyacetamide |
| SMILES | O=C(COc1ccc2nccnc2c1)NCc1ccco1 |
| InChI | InChI=1S/C15H13N3O3/c19-15(18-9-12-2-1-7-20-12)10-21-11-3-4-13-14(8-11)17-6-5-16-13/h1-8H,9-10H2,(H,18,19) |
| InChIKey | VPYXOYONYZWPDV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |