C14H11BrFNO4 — CID 8837303
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 8837303) has the molecular formula C14H11BrFNO4 and a molecular weight of 356.15 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8837303 |
| Molecular Formula | C14H11BrFNO4 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Br)NCc1ccco1 |
| InChI | InChI=1S/C14H11BrFNO4/c15-12-6-9(16)3-4-11(12)14(19)21-8-13(18)17-7-10-2-1-5-20-10/h1-6H,7-8H2,(H,17,18) |
| InChIKey | WVVXNUDPJZEJAJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |