About [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 8837297) has the molecular formula C16H12BrClFNO3
and a molecular weight of 400.63 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| PubChem CID | 8837297 |
| Molecular Formula | C16H12BrClFNO3 |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Br)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12BrClFNO3/c17-14-7-12(19)5-6-13(14)16(22)23-9-15(21)20-8-10-1-3-11(18)4-2-10/h1-7H,8-9H2,(H,20,21) |
| InChIKey | LAZZTPQLHGZGIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate?
The IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate (CID 8837297) is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate.
What is the SMILES notation for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate?
The canonical SMILES for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate is O=C(COC(=O)c1ccc(F)cc1Br)NCc1ccc(Cl)cc1.
What is the InChIKey of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate?
The InChIKey is LAZZTPQLHGZGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClFNO3/c17-14-7-12(19)5-6-13(14)16(22)23-9-15(21)20-8-10-1-3-11(18)4-2-10/h1-7H,8-9H2,(H,20,21).
What are the key properties of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate?
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate has a molecular weight of 400.63 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-bromo-4-fluorobenzoate is sourced from PubChem (CID 8837297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).