C18H15BrFNO4 — CID 8837578
[2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 8837578) has the molecular formula C18H15BrFNO4 and a molecular weight of 408.22 g/mol. Its IUPAC name is [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8837578 |
| Molecular Formula | C18H15BrFNO4 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)c2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C18H15BrFNO4/c1-11(22)21-9-12-2-4-13(5-3-12)17(23)10-25-18(24)15-7-6-14(20)8-16(15)19/h2-8H,9-10H2,1H3,(H,21,22) |
| InChIKey | UUKWVWPPIZHUOE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |