C19H19NO5 — CID 18195526
[2-(2-methoxyphenyl)-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 18195526) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 18195526 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | COc1ccccc1C(=O)COC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-13(21)20-11-14-7-9-15(10-8-14)19(23)25-12-17(22)16-5-3-4-6-18(16)24-2/h3-10H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | KNCZRMNKVVUBJD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |