C14H18N2O4 — CID 18195545
[2-(ethylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 18195545) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 18195545 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CCNC(=O)COC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-15-13(18)9-20-14(19)12-6-4-11(5-7-12)8-16-10(2)17/h4-7H,3,8-9H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | QBJKKRPLXBNDAE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |