C15H21N3O4 — CID 9228962
[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(dimethylamino)benzoate (PubChem CID 9228962) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 9228962 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(dimethylamino)benzoate |
| SMILES | CCNC(=O)CNC(=O)COC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O4/c1-4-16-13(19)9-17-14(20)10-22-15(21)11-5-7-12(8-6-11)18(2)3/h5-8H,4,9-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | UGZUQPBAPXTLLL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |