C16H22N2O5 — CID 8842622
[2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-propoxybenzoate (PubChem CID 8842622) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-propoxybenzoate.
| Compound Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 8842622 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-[[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(=O)NCC(=O)NCC)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-3-9-22-13-7-5-12(6-8-13)16(21)23-11-15(20)18-10-14(19)17-4-2/h5-8H,3-4,9-11H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | MRVLUHYBMQEVES-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |